C16H25NO4Si — CID 11404524
methyl 6-[2-(furan-3-yl)ethyl]-4-trimethylsilyloxy-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 11404524) has the molecular formula C16H25NO4Si and a molecular weight of 323.46 g/mol. Its IUPAC name is methyl 6-[2-(furan-3-yl)ethyl]-4-trimethylsilyloxy-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | methyl 6-[2-(furan-3-yl)ethyl]-4-trimethylsilyloxy-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 11404524 |
| Molecular Formula | C16H25NO4Si |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | methyl 6-[2-(furan-3-yl)ethyl]-4-trimethylsilyloxy-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | COC(=O)N1CCC(O[Si](C)(C)C)=CC1CCc1ccoc1 |
| InChI | InChI=1S/C16H25NO4Si/c1-19-16(18)17-9-7-15(21-22(2,3)4)11-14(17)6-5-13-8-10-20-12-13/h8,10-12,14H,5-7,9H2,1-4H3 |
| InChIKey | FMJZNBOCJHPSEJ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 51.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|