C18H26N2O4 — CID 11404861
(5S,6R)-3-[(2S,3R)-3-hydroxy-2,4-dimethylpentanoyl]-4,5-dimethyl-6-phenyl-1,3,4-oxadiazinan-2-one (PubChem CID 11404861) has the molecular formula C18H26N2O4 and a molecular weight of 334.42 g/mol. Its IUPAC name is (5S,6R)-3-[(2S,3R)-3-hydroxy-2,4-dimethylpentanoyl]-4,5-dimethyl-6-phenyl-1,3,4-oxadiazinan-2-one.
| Compound Name | (5S,6R)-3-[(2S,3R)-3-hydroxy-2,4-dimethylpentanoyl]-4,5-dimethyl-6-phenyl-1,3,4-oxadiazinan-2-one |
|---|---|
| PubChem CID | 11404861 |
| Molecular Formula | C18H26N2O4 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | (5S,6R)-3-[(2S,3R)-3-hydroxy-2,4-dimethylpentanoyl]-4,5-dimethyl-6-phenyl-1,3,4-oxadiazinan-2-one |
| SMILES | CC(C)[C@@H](O)[C@H](C)C(=O)N1C(=O)O[C@H](c2ccccc2)[C@H](C)N1C |
| InChI | InChI=1S/C18H26N2O4/c1-11(2)15(21)12(3)17(22)20-18(23)24-16(13(4)19(20)5)14-9-7-6-8-10-14/h6-13,15-16,21H,1-5H3/t12-,13-,15+,16-/m0/s1 |
| InChIKey | VTKPCABUKXIYSI-UGQVUOCMSA-N |
| XLogP | 2.59 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |