C13H15Br2NO2 — CID 114048915
2-bromo-1-[(2-bromocyclohexyl)methyl]-3-nitrobenzene (PubChem CID 114048915) has the molecular formula C13H15Br2NO2 and a molecular weight of 377.08 g/mol. Its IUPAC name is 2-bromo-1-[(2-bromocyclohexyl)methyl]-3-nitrobenzene.
| Compound Name | 2-bromo-1-[(2-bromocyclohexyl)methyl]-3-nitrobenzene |
|---|---|
| PubChem CID | 114048915 |
| Molecular Formula | C13H15Br2NO2 |
| Molecular Weight | 377.08 g/mol |
| Exact Mass | 374.95 |
| IUPAC Name | 2-bromo-1-[(2-bromocyclohexyl)methyl]-3-nitrobenzene |
| SMILES | O=[N+]([O-])c1cccc(CC2CCCCC2Br)c1Br |
| InChI | InChI=1S/C13H15Br2NO2/c14-11-6-2-1-4-9(11)8-10-5-3-7-12(13(10)15)16(17)18/h3,5,7,9,11H,1-2,4,6,8H2 |
| InChIKey | RARSXBZYZALLLI-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.08 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|