C10H5ClF3N3 — CID 114049719
5-chloro-6-(2,4,6-trifluorophenyl)pyrimidin-4-amine (PubChem CID 114049719) has the molecular formula C10H5ClF3N3 and a molecular weight of 259.62 g/mol. Its IUPAC name is 5-chloro-6-(2,4,6-trifluorophenyl)pyrimidin-4-amine.
| Compound Name | 5-chloro-6-(2,4,6-trifluorophenyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 114049719 |
| Molecular Formula | C10H5ClF3N3 |
| Molecular Weight | 259.62 g/mol |
| Exact Mass | 259.01 |
| IUPAC Name | 5-chloro-6-(2,4,6-trifluorophenyl)pyrimidin-4-amine |
| SMILES | Nc1ncnc(-c2c(F)cc(F)cc2F)c1Cl |
| InChI | InChI=1S/C10H5ClF3N3/c11-8-9(16-3-17-10(8)15)7-5(13)1-4(12)2-6(7)14/h1-3H,(H2,15,16,17) |
| InChIKey | MGRGHWAWVIUSME-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.62 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |