C10H11Cl2N3OS — CID 114051356
N-(2,6-dichloro-4-methyl-3-pyridinyl)-1,3-thiazolidine-4-carboxamide (PubChem CID 114051356) has the molecular formula C10H11Cl2N3OS and a molecular weight of 292.19 g/mol. Its IUPAC name is N-(2,6-dichloro-4-methyl-3-pyridinyl)-1,3-thiazolidine-4-carboxamide.
| Compound Name | N-(2,6-dichloro-4-methyl-3-pyridinyl)-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 114051356 |
| Molecular Formula | C10H11Cl2N3OS |
| Molecular Weight | 292.19 g/mol |
| Exact Mass | 291.00 |
| IUPAC Name | N-(2,6-dichloro-4-methyl-3-pyridinyl)-1,3-thiazolidine-4-carboxamide |
| SMILES | Cc1cc(Cl)nc(Cl)c1NC(=O)C1CSCN1 |
| InChI | InChI=1S/C10H11Cl2N3OS/c1-5-2-7(11)14-9(12)8(5)15-10(16)6-3-17-4-13-6/h2,6,13H,3-4H2,1H3,(H,15,16) |
| InChIKey | FOWXWRFVXIIIGH-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.19 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|