C17H16Cl2FNS — CID 11405596
4-[2-(2,3-dichlorophenyl)sulfanyl-5-fluorophenyl]piperidine (PubChem CID 11405596) has the molecular formula C17H16Cl2FNS and a molecular weight of 356.29 g/mol. Its IUPAC name is 4-[2-(2,3-dichlorophenyl)sulfanyl-5-fluorophenyl]piperidine.
| Compound Name | 4-[2-(2,3-dichlorophenyl)sulfanyl-5-fluorophenyl]piperidine |
|---|---|
| PubChem CID | 11405596 |
| Molecular Formula | C17H16Cl2FNS |
| Molecular Weight | 356.29 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | 4-[2-(2,3-dichlorophenyl)sulfanyl-5-fluorophenyl]piperidine |
| SMILES | Fc1ccc(Sc2cccc(Cl)c2Cl)c(C2CCNCC2)c1 |
| InChI | InChI=1S/C17H16Cl2FNS/c18-14-2-1-3-16(17(14)19)22-15-5-4-12(20)10-13(15)11-6-8-21-9-7-11/h1-5,10-11,21H,6-9H2 |
| InChIKey | QDHZTAUVQQINSG-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.29 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |