C21H20ClF2NO4S — CID 160813578
(E)-but-2-enedioic acid;4-[2-(4-chloro-2-fluorophenyl)sulfanyl-5-fluorophenyl]piperidine (PubChem CID 160813578) has the molecular formula C21H20ClF2NO4S and a molecular weight of 455.91 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;4-[2-(4-chloro-2-fluorophenyl)sulfanyl-5-fluorophenyl]piperidine.
| Compound Name | (E)-but-2-enedioic acid;4-[2-(4-chloro-2-fluorophenyl)sulfanyl-5-fluorophenyl]piperidine |
|---|---|
| PubChem CID | 160813578 |
| Molecular Formula | C21H20ClF2NO4S |
| Molecular Weight | 455.91 g/mol |
| Exact Mass | 455.08 |
| IUPAC Name | (E)-but-2-enedioic acid;4-[2-(4-chloro-2-fluorophenyl)sulfanyl-5-fluorophenyl]piperidine |
| SMILES | Fc1ccc(Sc2ccc(Cl)cc2F)c(C2CCNCC2)c1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C17H16ClF2NS.C4H4O4/c18-12-1-3-17(15(20)9-12)22-16-4-2-13(19)10-14(16)11-5-7-21-8-6-11;5-3(6)1-2-4(7)8/h1-4,9-11,21H,5-8H2;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | SEPOSVVFUXWWQE-WLHGVMLRSA-N |
| XLogP | 4.95 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.91 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|