C18H19ClFNS — CID 11279102
4-[2-(2-chloro-4-fluorophenyl)sulfanyl-5-methylphenyl]piperidine (PubChem CID 11279102) has the molecular formula C18H19ClFNS and a molecular weight of 335.88 g/mol. Its IUPAC name is 4-[2-(2-chloro-4-fluorophenyl)sulfanyl-5-methylphenyl]piperidine.
| Compound Name | 4-[2-(2-chloro-4-fluorophenyl)sulfanyl-5-methylphenyl]piperidine |
|---|---|
| PubChem CID | 11279102 |
| Molecular Formula | C18H19ClFNS |
| Molecular Weight | 335.88 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | 4-[2-(2-chloro-4-fluorophenyl)sulfanyl-5-methylphenyl]piperidine |
| SMILES | Cc1ccc(Sc2ccc(F)cc2Cl)c(C2CCNCC2)c1 |
| InChI | InChI=1S/C18H19ClFNS/c1-12-2-4-17(15(10-12)13-6-8-21-9-7-13)22-18-5-3-14(20)11-16(18)19/h2-5,10-11,13,21H,6-9H2,1H3 |
| InChIKey | HVJZTWXFHZTYFM-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.88 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |