C19H22FNOS — CID 11427529
4-[5-fluoro-2-(4-methoxy-2-methylphenyl)sulfanylphenyl]piperidine (PubChem CID 11427529) has the molecular formula C19H22FNOS and a molecular weight of 331.46 g/mol. Its IUPAC name is 4-[5-fluoro-2-(4-methoxy-2-methylphenyl)sulfanylphenyl]piperidine.
| Compound Name | 4-[5-fluoro-2-(4-methoxy-2-methylphenyl)sulfanylphenyl]piperidine |
|---|---|
| PubChem CID | 11427529 |
| Molecular Formula | C19H22FNOS |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | 4-[5-fluoro-2-(4-methoxy-2-methylphenyl)sulfanylphenyl]piperidine |
| SMILES | COc1ccc(Sc2ccc(F)cc2C2CCNCC2)c(C)c1 |
| InChI | InChI=1S/C19H22FNOS/c1-13-11-16(22-2)4-6-18(13)23-19-5-3-15(20)12-17(19)14-7-9-21-10-8-14/h3-6,11-12,14,21H,7-10H2,1-2H3 |
| InChIKey | JMTIAZQISVPRER-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |