C20H20ClNO3 — CID 11405651
2-(4-chlorophenyl)-4-morpholin-4-yl-1-phenylbutane-1,4-dione (PubChem CID 11405651) has the molecular formula C20H20ClNO3 and a molecular weight of 357.84 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-4-morpholin-4-yl-1-phenylbutane-1,4-dione.
| Compound Name | 2-(4-chlorophenyl)-4-morpholin-4-yl-1-phenylbutane-1,4-dione |
|---|---|
| PubChem CID | 11405651 |
| Molecular Formula | C20H20ClNO3 |
| Molecular Weight | 357.84 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | 2-(4-chlorophenyl)-4-morpholin-4-yl-1-phenylbutane-1,4-dione |
| SMILES | O=C(c1ccccc1)C(CC(=O)N1CCOCC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H20ClNO3/c21-17-8-6-15(7-9-17)18(20(24)16-4-2-1-3-5-16)14-19(23)22-10-12-25-13-11-22/h1-9,18H,10-14H2 |
| InChIKey | HQHXGTMPHKFUJN-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.84 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |