C17H25IO — CID 11406114
[(1R,2S,3R)-2-hexyl-3-iodo-2-methyl-1-phenylcyclopropyl]methanol (PubChem CID 11406114) has the molecular formula C17H25IO and a molecular weight of 372.29 g/mol. Its IUPAC name is [(1R,2S,3R)-2-hexyl-3-iodo-2-methyl-1-phenylcyclopropyl]methanol.
| Compound Name | [(1R,2S,3R)-2-hexyl-3-iodo-2-methyl-1-phenylcyclopropyl]methanol |
|---|---|
| PubChem CID | 11406114 |
| Molecular Formula | C17H25IO |
| Molecular Weight | 372.29 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | [(1R,2S,3R)-2-hexyl-3-iodo-2-methyl-1-phenylcyclopropyl]methanol |
| SMILES | CCCCCC[C@]1(C)[C@@H](I)[C@]1(CO)c1ccccc1 |
| InChI | InChI=1S/C17H25IO/c1-3-4-5-9-12-16(2)15(18)17(16,13-19)14-10-7-6-8-11-14/h6-8,10-11,15,19H,3-5,9,12-13H2,1-2H3/t15-,16-,17+/m1/s1 |
| InChIKey | LJWNLGZNOBUQBJ-ZACQAIPSSA-N |
| XLogP | 4.71 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.29 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|