C16H19F3O2S — CID 102061909
(4R,5R)-4-hexyl-4-phenyl-5-(trifluoromethyl)-1,3-dioxolane-2-thione (PubChem CID 102061909) has the molecular formula C16H19F3O2S and a molecular weight of 332.39 g/mol. Its IUPAC name is (4R,5R)-4-hexyl-4-phenyl-5-(trifluoromethyl)-1,3-dioxolane-2-thione.
| Compound Name | (4R,5R)-4-hexyl-4-phenyl-5-(trifluoromethyl)-1,3-dioxolane-2-thione |
|---|---|
| PubChem CID | 102061909 |
| Molecular Formula | C16H19F3O2S |
| Molecular Weight | 332.39 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | (4R,5R)-4-hexyl-4-phenyl-5-(trifluoromethyl)-1,3-dioxolane-2-thione |
| SMILES | CCCCCC[C@]1(c2ccccc2)OC(=S)O[C@H]1C(F)(F)F |
| InChI | InChI=1S/C16H19F3O2S/c1-2-3-4-8-11-15(12-9-6-5-7-10-12)13(16(17,18)19)20-14(22)21-15/h5-7,9-10,13H,2-4,8,11H2,1H3/t13-,15-/m1/s1 |
| InChIKey | MGPFWQVEDUXFNB-UKRRQHHQSA-N |
| XLogP | 5.11 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.39 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|