C18H29F2N3O2Si — CID 11406511
tert-butyl N-[[2,6-difluoro-4-[N'-(2-trimethylsilylethyl)carbamimidoyl]phenyl]methyl]carbamate (PubChem CID 11406511) has the molecular formula C18H29F2N3O2Si and a molecular weight of 385.53 g/mol. Its IUPAC name is tert-butyl N-[[2,6-difluoro-4-[N'-(2-trimethylsilylethyl)carbamimidoyl]phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[2,6-difluoro-4-[N'-(2-trimethylsilylethyl)carbamimidoyl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 11406511 |
| Molecular Formula | C18H29F2N3O2Si |
| Molecular Weight | 385.53 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | tert-butyl N-[[2,6-difluoro-4-[N'-(2-trimethylsilylethyl)carbamimidoyl]phenyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1c(F)cc(/C(N)=N/CC[Si](C)(C)C)cc1F |
| InChI | InChI=1S/C18H29F2N3O2Si/c1-18(2,3)25-17(24)23-11-13-14(19)9-12(10-15(13)20)16(21)22-7-8-26(4,5)6/h9-10H,7-8,11H2,1-6H3,(H2,21,22)(H,23,24) |
| InChIKey | CFQOSILLNZBTEP-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.53 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|