C10H12BrN5O2 — CID 114072480
4-[5-bromo-6-(methylamino)pyrimidin-4-yl]-3-methylpiperazine-2,6-dione (PubChem CID 114072480) has the molecular formula C10H12BrN5O2 and a molecular weight of 314.14 g/mol. Its IUPAC name is 4-[5-bromo-6-(methylamino)pyrimidin-4-yl]-3-methylpiperazine-2,6-dione.
| Compound Name | 4-[5-bromo-6-(methylamino)pyrimidin-4-yl]-3-methylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 114072480 |
| Molecular Formula | C10H12BrN5O2 |
| Molecular Weight | 314.14 g/mol |
| Exact Mass | 313.02 |
| IUPAC Name | 4-[5-bromo-6-(methylamino)pyrimidin-4-yl]-3-methylpiperazine-2,6-dione |
| SMILES | CNc1ncnc(N2CC(=O)NC(=O)C2C)c1Br |
| InChI | InChI=1S/C10H12BrN5O2/c1-5-10(18)15-6(17)3-16(5)9-7(11)8(12-2)13-4-14-9/h4-5H,3H2,1-2H3,(H,12,13,14)(H,15,17,18) |
| InChIKey | KNLNIOBZZRXASO-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.14 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|