C11H7Cl2N3O3 — CID 114073603
N-(2,6-dichloropyrimidin-4-yl)-2,6-dihydroxybenzamide (PubChem CID 114073603) has the molecular formula C11H7Cl2N3O3 and a molecular weight of 300.10 g/mol. Its IUPAC name is N-(2,6-dichloropyrimidin-4-yl)-2,6-dihydroxybenzamide.
| Compound Name | N-(2,6-dichloropyrimidin-4-yl)-2,6-dihydroxybenzamide |
|---|---|
| PubChem CID | 114073603 |
| Molecular Formula | C11H7Cl2N3O3 |
| Molecular Weight | 300.10 g/mol |
| Exact Mass | 298.99 |
| IUPAC Name | N-(2,6-dichloropyrimidin-4-yl)-2,6-dihydroxybenzamide |
| SMILES | O=C(Nc1cc(Cl)nc(Cl)n1)c1c(O)cccc1O |
| InChI | InChI=1S/C11H7Cl2N3O3/c12-7-4-8(16-11(13)14-7)15-10(19)9-5(17)2-1-3-6(9)18/h1-4,17-18H,(H,14,15,16,19) |
| InChIKey | YLXPZQMGHDUYMV-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.10 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |