C11H12Cl2N2S2 — CID 114082857
4-[4-(2,5-dichlorothiophen-3-yl)-1,3-thiazol-2-yl]butan-1-amine (PubChem CID 114082857) has the molecular formula C11H12Cl2N2S2 and a molecular weight of 307.27 g/mol. Its IUPAC name is 4-[4-(2,5-dichlorothiophen-3-yl)-1,3-thiazol-2-yl]butan-1-amine.
| Compound Name | 4-[4-(2,5-dichlorothiophen-3-yl)-1,3-thiazol-2-yl]butan-1-amine |
|---|---|
| PubChem CID | 114082857 |
| Molecular Formula | C11H12Cl2N2S2 |
| Molecular Weight | 307.27 g/mol |
| Exact Mass | 305.98 |
| IUPAC Name | 4-[4-(2,5-dichlorothiophen-3-yl)-1,3-thiazol-2-yl]butan-1-amine |
| SMILES | NCCCCc1nc(-c2cc(Cl)sc2Cl)cs1 |
| InChI | InChI=1S/C11H12Cl2N2S2/c12-9-5-7(11(13)17-9)8-6-16-10(15-8)3-1-2-4-14/h5-6H,1-4,14H2 |
| InChIKey | VVVZZHXTECBXNU-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.27 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|