C11H17ClN4O2 — CID 114100399
3-chloro-2-(2,3-dimethoxypropylamino)pyridine-4-carboximidamide (PubChem CID 114100399) has the molecular formula C11H17ClN4O2 and a molecular weight of 272.74 g/mol. Its IUPAC name is 3-chloro-2-(2,3-dimethoxypropylamino)pyridine-4-carboximidamide.
| Compound Name | 3-chloro-2-(2,3-dimethoxypropylamino)pyridine-4-carboximidamide |
|---|---|
| PubChem CID | 114100399 |
| Molecular Formula | C11H17ClN4O2 |
| Molecular Weight | 272.74 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 3-chloro-2-(2,3-dimethoxypropylamino)pyridine-4-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccnc(NCC(COC)OC)c1Cl |
| InChI | InChI=1S/C11H17ClN4O2/c1-17-6-7(18-2)5-16-11-9(12)8(10(13)14)3-4-15-11/h3-4,7H,5-6H2,1-2H3,(H3,13,14)(H,15,16) |
| InChIKey | NABZZJFUVJDXOG-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 93.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.74 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|