C13H17FN2O2 — CID 114101743
2-amino-5-[(1-ethylcyclopropyl)methylamino]-4-fluorobenzoic acid (PubChem CID 114101743) has the molecular formula C13H17FN2O2 and a molecular weight of 252.29 g/mol. Its IUPAC name is 2-amino-5-[(1-ethylcyclopropyl)methylamino]-4-fluorobenzoic acid.
| Compound Name | 2-amino-5-[(1-ethylcyclopropyl)methylamino]-4-fluorobenzoic acid |
|---|---|
| PubChem CID | 114101743 |
| Molecular Formula | C13H17FN2O2 |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | 2-amino-5-[(1-ethylcyclopropyl)methylamino]-4-fluorobenzoic acid |
| SMILES | CCC1(CNc2cc(C(=O)O)c(N)cc2F)CC1 |
| InChI | InChI=1S/C13H17FN2O2/c1-2-13(3-4-13)7-16-11-5-8(12(17)18)10(15)6-9(11)14/h5-6,16H,2-4,7,15H2,1H3,(H,17,18) |
| InChIKey | ITPGWTSBXRLBNE-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|