C11H24N2O3S2 — CID 114113863
2-[(1-ethoxy-3-methylbutan-2-yl)sulfamoyl]butanethioamide (PubChem CID 114113863) has the molecular formula C11H24N2O3S2 and a molecular weight of 296.46 g/mol. Its IUPAC name is 2-[(1-ethoxy-3-methylbutan-2-yl)sulfamoyl]butanethioamide.
| Compound Name | 2-[(1-ethoxy-3-methylbutan-2-yl)sulfamoyl]butanethioamide |
|---|---|
| PubChem CID | 114113863 |
| Molecular Formula | C11H24N2O3S2 |
| Molecular Weight | 296.46 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | 2-[(1-ethoxy-3-methylbutan-2-yl)sulfamoyl]butanethioamide |
| SMILES | CCOCC(NS(=O)(=O)C(CC)C(N)=S)C(C)C |
| InChI | InChI=1S/C11H24N2O3S2/c1-5-10(11(12)17)18(14,15)13-9(8(3)4)7-16-6-2/h8-10,13H,5-7H2,1-4H3,(H2,12,17) |
| InChIKey | OHUYQELOSHEPKA-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.46 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|