C46H28N6O2Zn — CID 11411676
zinc 2-[2-nitro-5-(10,15,20-triphenylporphyrin-22,24-diid-5-yl)phenyl]acetonitrile (PubChem CID 11411676) has the molecular formula C46H28N6O2Zn and a molecular weight of 762.16 g/mol. Its IUPAC name is zinc 2-[2-nitro-5-(10,15,20-triphenylporphyrin-22,24-diid-5-yl)phenyl]acetonitrile.
| Compound Name | zinc 2-[2-nitro-5-(10,15,20-triphenylporphyrin-22,24-diid-5-yl)phenyl]acetonitrile |
|---|---|
| PubChem CID | 11411676 |
| Molecular Formula | C46H28N6O2Zn |
| Molecular Weight | 762.16 g/mol |
| Exact Mass | 760.16 |
| IUPAC Name | zinc 2-[2-nitro-5-(10,15,20-triphenylporphyrin-22,24-diid-5-yl)phenyl]acetonitrile |
| SMILES | N#CCc1cc(-c2c3nc(c(-c4ccccc4)c4ccc([n-]4)c(-c4ccccc4)c4nc(c(-c5ccccc5)c5ccc2[n-]5)C=C4)C=C3)ccc1[N+](=O)[O-].[Zn+2] |
| InChI | InChI=1S/C46H28N6O2.Zn/c47-27-26-32-28-33(16-25-42(32)52(53)54)46-40-23-21-38(50-40)44(30-12-6-2-7-13-30)36-19-17-34(48-36)43(29-10-4-1-5-11-29)35-18-20-37(49-35)45(31-14-8-3-9-15-31)39-22-24-41(46)51-39;/h1-25,28H,26H2;/q-2;+2/b43-34-,43-35-,44-36-,44-38-,45-37-,45-39-,46-40-,46-41-; |
| InChIKey | ZGZNDOAHSFQLDX-KGFAVFJISA-N |
| XLogP | 10.55 |
| TPSA | 120.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.16 |
| LogP ≤ 5 | 10.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|