C51H33N5O4SZn — CID 11714880
zinc 5-[3-(benzenesulfonylmethyl)-4-nitrophenyl]-10,15,20-triphenylporphyrin-22,24-diide (PubChem CID 11714880) has the molecular formula C51H33N5O4SZn and a molecular weight of 877.31 g/mol. Its IUPAC name is zinc 5-[3-(benzenesulfonylmethyl)-4-nitrophenyl]-10,15,20-triphenylporphyrin-22,24-diide.
| Compound Name | zinc 5-[3-(benzenesulfonylmethyl)-4-nitrophenyl]-10,15,20-triphenylporphyrin-22,24-diide |
|---|---|
| PubChem CID | 11714880 |
| Molecular Formula | C51H33N5O4SZn |
| Molecular Weight | 877.31 g/mol |
| Exact Mass | 875.15 |
| IUPAC Name | zinc 5-[3-(benzenesulfonylmethyl)-4-nitrophenyl]-10,15,20-triphenylporphyrin-22,24-diide |
| SMILES | O=[N+]([O-])c1ccc(-c2c3nc(c(-c4ccccc4)c4ccc([n-]4)c(-c4ccccc4)c4nc(c(-c5ccccc5)c5ccc2[n-]5)C=C4)C=C3)cc1CS(=O)(=O)c1ccccc1.[Zn+2] |
| InChI | InChI=1S/C51H33N5O4S.Zn/c57-56(58)47-30-21-36(31-37(47)32-61(59,60)38-19-11-4-12-20-38)51-45-28-26-43(54-45)49(34-15-7-2-8-16-34)41-24-22-39(52-41)48(33-13-5-1-6-14-33)40-23-25-42(53-40)50(35-17-9-3-10-18-35)44-27-29-46(51)55-44;/h1-31H,32H2;/q-2;+2/b48-39-,48-40-,49-41-,49-43-,50-42-,50-44-,51-45-,51-46-; |
| InChIKey | QKUMTIFWVCFILY-NJLIRLSYSA-N |
| XLogP | 11.46 |
| TPSA | 131.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 877.31 |
| LogP ≤ 5 | 11.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|