C38H44N6O6S — CID 11411829
(2S,5S,8R,12R)-5,8-dibenzyl-12-[(1,1-dioxothian-4-yl)amino]-2-(1H-indol-3-ylmethyl)-1,4,7,10-tetrazacyclotetradecane-3,6,11,14-tetrone (PubChem CID 11411829) has the molecular formula C38H44N6O6S and a molecular weight of 712.87 g/mol. Its IUPAC name is (2S,5S,8R,12R)-5,8-dibenzyl-12-[(1,1-dioxothian-4-yl)amino]-2-(1H-indol-3-ylmethyl)-1,4,7,10-tetrazacyclotetradecane-3,6,11,14-tetrone.
| Compound Name | (2S,5S,8R,12R)-5,8-dibenzyl-12-[(1,1-dioxothian-4-yl)amino]-2-(1H-indol-3-ylmethyl)-1,4,7,10-tetrazacyclotetradecane-3,6,11,14-tetrone |
|---|---|
| PubChem CID | 11411829 |
| Molecular Formula | C38H44N6O6S |
| Molecular Weight | 712.87 g/mol |
| Exact Mass | 712.30 |
| IUPAC Name | (2S,5S,8R,12R)-5,8-dibenzyl-12-[(1,1-dioxothian-4-yl)amino]-2-(1H-indol-3-ylmethyl)-1,4,7,10-tetrazacyclotetradecane-3,6,11,14-tetrone |
| SMILES | O=C1C[C@@H](NC2CCS(=O)(=O)CC2)C(=O)NC[C@@H](Cc2ccccc2)NC(=O)[C@H](Cc2ccccc2)NC(=O)[C@H](Cc2c[nH]c3ccccc23)N1 |
| InChI | InChI=1S/C38H44N6O6S/c45-35-22-34(41-28-15-17-51(49,50)18-16-28)36(46)40-24-29(19-25-9-3-1-4-10-25)42-37(47)32(20-26-11-5-2-6-12-26)44-38(48)33(43-35)21-27-23-39-31-14-8-7-13-30(27)31/h1-14,23,28-29,32-34,39,41H,15-22,24H2,(H,40,46)(H,42,47)(H,43,45)(H,44,48)/t29-,32+,33+,34-/m1/s1 |
| InChIKey | UMSSCTNYYHRMNN-ODRDEDCPSA-N |
| XLogP | 1.71 |
| TPSA | 178.36 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.87 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |