C42H51N7O7 — CID 177390652
(8R)-5,8-dibenzyl-12-[4-[2-(2-hydroxyethoxy)ethyl]piperazine-1-carbonyl]-2-(1H-indol-3-ylmethyl)-1,4,7,10-tetrazacyclotetradecane-3,6,11,14-tetrone (PubChem CID 177390652) has the molecular formula C42H51N7O7 and a molecular weight of 765.91 g/mol. Its IUPAC name is (8R)-5,8-dibenzyl-12-[4-[2-(2-hydroxyethoxy)ethyl]piperazine-1-carbonyl]-2-(1H-indol-3-ylmethyl)-1,4,7,10-tetrazacyclotetradecane-3,6,11,14-tetrone.
| Compound Name | (8R)-5,8-dibenzyl-12-[4-[2-(2-hydroxyethoxy)ethyl]piperazine-1-carbonyl]-2-(1H-indol-3-ylmethyl)-1,4,7,10-tetrazacyclotetradecane-3,6,11,14-tetrone |
|---|---|
| PubChem CID | 177390652 |
| Molecular Formula | C42H51N7O7 |
| Molecular Weight | 765.91 g/mol |
| Exact Mass | 765.38 |
| IUPAC Name | (8R)-5,8-dibenzyl-12-[4-[2-(2-hydroxyethoxy)ethyl]piperazine-1-carbonyl]-2-(1H-indol-3-ylmethyl)-1,4,7,10-tetrazacyclotetradecane-3,6,11,14-tetrone |
| SMILES | O=C1CC(C(=O)N2CCN(CCOCCO)CC2)C(=O)NC[C@@H](Cc2ccccc2)NC(=O)C(Cc2ccccc2)NC(=O)C(Cc2c[nH]c3ccccc23)N1 |
| InChI | InChI=1S/C42H51N7O7/c50-20-22-56-21-19-48-15-17-49(18-16-48)42(55)34-26-38(51)46-37(25-31-27-43-35-14-8-7-13-33(31)35)41(54)47-36(24-30-11-5-2-6-12-30)40(53)45-32(28-44-39(34)52)23-29-9-3-1-4-10-29/h1-14,27,32,34,36-37,43,50H,15-26,28H2,(H,44,52)(H,45,53)(H,46,51)(H,47,54)/t32-,34?,36?,37?/m1/s1 |
| InChIKey | CYHLISRFWYDECV-KBJZZXDQSA-N |
| XLogP | 0.94 |
| TPSA | 185.20 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.91 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|