C10H20F2N4O — CID 114128970
1-amino-3-cyclopentyl-2-[2-(2,2-difluoroethoxy)ethyl]guanidine (PubChem CID 114128970) has the molecular formula C10H20F2N4O and a molecular weight of 250.29 g/mol. Its IUPAC name is 1-amino-3-cyclopentyl-2-[2-(2,2-difluoroethoxy)ethyl]guanidine.
| Compound Name | 1-amino-3-cyclopentyl-2-[2-(2,2-difluoroethoxy)ethyl]guanidine |
|---|---|
| PubChem CID | 114128970 |
| Molecular Formula | C10H20F2N4O |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | 1-amino-3-cyclopentyl-2-[2-(2,2-difluoroethoxy)ethyl]guanidine |
| SMILES | NN/C(=N\CCOCC(F)F)NC1CCCC1 |
| InChI | InChI=1S/C10H20F2N4O/c11-9(12)7-17-6-5-14-10(16-13)15-8-3-1-2-4-8/h8-9H,1-7,13H2,(H2,14,15,16) |
| InChIKey | DPDXVUYQICQESH-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 71.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|