C11H11BrClN3S2 — CID 114139531
N-[2-(5-bromothiophen-2-yl)ethyl]-6-chloro-2-methylsulfanylpyrimidin-4-amine (PubChem CID 114139531) has the molecular formula C11H11BrClN3S2 and a molecular weight of 364.72 g/mol. Its IUPAC name is N-[2-(5-bromothiophen-2-yl)ethyl]-6-chloro-2-methylsulfanylpyrimidin-4-amine.
| Compound Name | N-[2-(5-bromothiophen-2-yl)ethyl]-6-chloro-2-methylsulfanylpyrimidin-4-amine |
|---|---|
| PubChem CID | 114139531 |
| Molecular Formula | C11H11BrClN3S2 |
| Molecular Weight | 364.72 g/mol |
| Exact Mass | 362.93 |
| IUPAC Name | N-[2-(5-bromothiophen-2-yl)ethyl]-6-chloro-2-methylsulfanylpyrimidin-4-amine |
| SMILES | CSc1nc(Cl)cc(NCCc2ccc(Br)s2)n1 |
| InChI | InChI=1S/C11H11BrClN3S2/c1-17-11-15-9(13)6-10(16-11)14-5-4-7-2-3-8(12)18-7/h2-3,6H,4-5H2,1H3,(H,14,15,16) |
| InChIKey | DITKFOFWVMVIDM-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.72 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |