C10H12BrF3N2OS — CID 114140444
2-[2-(5-bromothiophen-2-yl)ethylamino]-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 114140444) has the molecular formula C10H12BrF3N2OS and a molecular weight of 345.18 g/mol. Its IUPAC name is 2-[2-(5-bromothiophen-2-yl)ethylamino]-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-[2-(5-bromothiophen-2-yl)ethylamino]-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 114140444 |
| Molecular Formula | C10H12BrF3N2OS |
| Molecular Weight | 345.18 g/mol |
| Exact Mass | 343.98 |
| IUPAC Name | 2-[2-(5-bromothiophen-2-yl)ethylamino]-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | O=C(CNCCc1ccc(Br)s1)NCC(F)(F)F |
| InChI | InChI=1S/C10H12BrF3N2OS/c11-8-2-1-7(18-8)3-4-15-5-9(17)16-6-10(12,13)14/h1-2,15H,3-6H2,(H,16,17) |
| InChIKey | KXJHXXHMIKDCOV-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.18 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|