C14H25NO5 — CID 11414981
tert-butyl N-[(1S,2S)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxybut-3-enyl]carbamate (PubChem CID 11414981) has the molecular formula C14H25NO5 and a molecular weight of 287.36 g/mol. Its IUPAC name is tert-butyl N-[(1S,2S)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxybut-3-enyl]carbamate.
| Compound Name | tert-butyl N-[(1S,2S)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxybut-3-enyl]carbamate |
|---|---|
| PubChem CID | 11414981 |
| Molecular Formula | C14H25NO5 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | tert-butyl N-[(1S,2S)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxybut-3-enyl]carbamate |
| SMILES | C=C[C@H](O)[C@H](NC(=O)OC(C)(C)C)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C14H25NO5/c1-7-9(16)11(10-8-18-14(5,6)19-10)15-12(17)20-13(2,3)4/h7,9-11,16H,1,8H2,2-6H3,(H,15,17)/t9-,10+,11-/m0/s1 |
| InChIKey | PXCCGEKPPWQLPF-AXFHLTTASA-N |
| XLogP | 1.58 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|