C9H10F3N3O2 — CID 114158767
methyl 5-amino-1-[1-(trifluoromethyl)cyclopropyl]imidazole-4-carboxylate (PubChem CID 114158767) has the molecular formula C9H10F3N3O2 and a molecular weight of 249.19 g/mol. Its IUPAC name is methyl 5-amino-1-[1-(trifluoromethyl)cyclopropyl]imidazole-4-carboxylate.
| Compound Name | methyl 5-amino-1-[1-(trifluoromethyl)cyclopropyl]imidazole-4-carboxylate |
|---|---|
| PubChem CID | 114158767 |
| Molecular Formula | C9H10F3N3O2 |
| Molecular Weight | 249.19 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | methyl 5-amino-1-[1-(trifluoromethyl)cyclopropyl]imidazole-4-carboxylate |
| SMILES | COC(=O)c1ncn(C2(C(F)(F)F)CC2)c1N |
| InChI | InChI=1S/C9H10F3N3O2/c1-17-7(16)5-6(13)15(4-14-5)8(2-3-8)9(10,11)12/h4H,2-3,13H2,1H3 |
| InChIKey | UETKOZXKYMCBBV-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.19 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |