C13H18BrNO4 — CID 114163803
3-bromo-4-[[(3-hydroxy-4-methoxybutyl)amino]methyl]benzoic acid (PubChem CID 114163803) has the molecular formula C13H18BrNO4 and a molecular weight of 332.19 g/mol. Its IUPAC name is 3-bromo-4-[[(3-hydroxy-4-methoxybutyl)amino]methyl]benzoic acid.
| Compound Name | 3-bromo-4-[[(3-hydroxy-4-methoxybutyl)amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 114163803 |
| Molecular Formula | C13H18BrNO4 |
| Molecular Weight | 332.19 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | 3-bromo-4-[[(3-hydroxy-4-methoxybutyl)amino]methyl]benzoic acid |
| SMILES | COCC(O)CCNCc1ccc(C(=O)O)cc1Br |
| InChI | InChI=1S/C13H18BrNO4/c1-19-8-11(16)4-5-15-7-10-3-2-9(13(17)18)6-12(10)14/h2-3,6,11,15-16H,4-5,7-8H2,1H3,(H,17,18) |
| InChIKey | MKPUBPSMFPQRBA-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.19 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|