C13H14N4O5S — CID 11416467
1-(2,4-dimethoxy-5-nitrophenyl)-3-(5-methyl-1,3-thiazol-2-yl)urea (PubChem CID 11416467) has the molecular formula C13H14N4O5S and a molecular weight of 338.35 g/mol. Its IUPAC name is 1-(2,4-dimethoxy-5-nitrophenyl)-3-(5-methyl-1,3-thiazol-2-yl)urea.
| Compound Name | 1-(2,4-dimethoxy-5-nitrophenyl)-3-(5-methyl-1,3-thiazol-2-yl)urea |
|---|---|
| PubChem CID | 11416467 |
| Molecular Formula | C13H14N4O5S |
| Molecular Weight | 338.35 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | 1-(2,4-dimethoxy-5-nitrophenyl)-3-(5-methyl-1,3-thiazol-2-yl)urea |
| SMILES | COc1cc(OC)c([N+](=O)[O-])cc1NC(=O)Nc1ncc(C)s1 |
| InChI | InChI=1S/C13H14N4O5S/c1-7-6-14-13(23-7)16-12(18)15-8-4-9(17(19)20)11(22-3)5-10(8)21-2/h4-6H,1-3H3,(H2,14,15,16,18) |
| InChIKey | DNGKAYRZEKYURF-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 115.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.35 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|