C13H22ClN3O — CID 114177902
N-(1-chloro-4,4-dimethylpentan-3-yl)-1,5-dimethylpyrazole-4-carboxamide (PubChem CID 114177902) has the molecular formula C13H22ClN3O and a molecular weight of 271.79 g/mol. Its IUPAC name is N-(1-chloro-4,4-dimethylpentan-3-yl)-1,5-dimethylpyrazole-4-carboxamide.
| Compound Name | N-(1-chloro-4,4-dimethylpentan-3-yl)-1,5-dimethylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 114177902 |
| Molecular Formula | C13H22ClN3O |
| Molecular Weight | 271.79 g/mol |
| Exact Mass | 271.15 |
| IUPAC Name | N-(1-chloro-4,4-dimethylpentan-3-yl)-1,5-dimethylpyrazole-4-carboxamide |
| SMILES | Cc1c(C(=O)NC(CCCl)C(C)(C)C)cnn1C |
| InChI | InChI=1S/C13H22ClN3O/c1-9-10(8-15-17(9)5)12(18)16-11(6-7-14)13(2,3)4/h8,11H,6-7H2,1-5H3,(H,16,18) |
| InChIKey | AXWVJLUJCGMPAH-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.79 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|