C12H15N3O2 — CID 114183269
3-[1-[2-(1,2,4-oxadiazol-5-yl)ethylamino]ethyl]phenol (PubChem CID 114183269) has the molecular formula C12H15N3O2 and a molecular weight of 233.27 g/mol. Its IUPAC name is 3-[1-[2-(1,2,4-oxadiazol-5-yl)ethylamino]ethyl]phenol.
| Compound Name | 3-[1-[2-(1,2,4-oxadiazol-5-yl)ethylamino]ethyl]phenol |
|---|---|
| PubChem CID | 114183269 |
| Molecular Formula | C12H15N3O2 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | 3-[1-[2-(1,2,4-oxadiazol-5-yl)ethylamino]ethyl]phenol |
| SMILES | CC(NCCc1ncno1)c1cccc(O)c1 |
| InChI | InChI=1S/C12H15N3O2/c1-9(10-3-2-4-11(16)7-10)13-6-5-12-14-8-15-17-12/h2-4,7-9,13,16H,5-6H2,1H3 |
| InChIKey | CFCDOGFADIQSAX-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 71.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |