C10H14F3NO3S — CID 114187415
3-[2-(trifluoromethylsulfanyl)ethylcarbamoyl]cyclopentane-1-carboxylic acid (PubChem CID 114187415) has the molecular formula C10H14F3NO3S and a molecular weight of 285.29 g/mol. Its IUPAC name is 3-[2-(trifluoromethylsulfanyl)ethylcarbamoyl]cyclopentane-1-carboxylic acid.
| Compound Name | 3-[2-(trifluoromethylsulfanyl)ethylcarbamoyl]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 114187415 |
| Molecular Formula | C10H14F3NO3S |
| Molecular Weight | 285.29 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | 3-[2-(trifluoromethylsulfanyl)ethylcarbamoyl]cyclopentane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(C(=O)NCCSC(F)(F)F)C1 |
| InChI | InChI=1S/C10H14F3NO3S/c11-10(12,13)18-4-3-14-8(15)6-1-2-7(5-6)9(16)17/h6-7H,1-5H2,(H,14,15)(H,16,17) |
| InChIKey | MJVCGUKVYWQWGV-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.29 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|