C12H15NO5S — CID 114188481
5-[(2-hydroxy-2-thiophen-3-ylethyl)carbamoyl]oxolane-2-carboxylic acid (PubChem CID 114188481) has the molecular formula C12H15NO5S and a molecular weight of 285.32 g/mol. Its IUPAC name is 5-[(2-hydroxy-2-thiophen-3-ylethyl)carbamoyl]oxolane-2-carboxylic acid.
| Compound Name | 5-[(2-hydroxy-2-thiophen-3-ylethyl)carbamoyl]oxolane-2-carboxylic acid |
|---|---|
| PubChem CID | 114188481 |
| Molecular Formula | C12H15NO5S |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | 5-[(2-hydroxy-2-thiophen-3-ylethyl)carbamoyl]oxolane-2-carboxylic acid |
| SMILES | O=C(O)C1CCC(C(=O)NCC(O)c2ccsc2)O1 |
| InChI | InChI=1S/C12H15NO5S/c14-8(7-3-4-19-6-7)5-13-11(15)9-1-2-10(18-9)12(16)17/h3-4,6,8-10,14H,1-2,5H2,(H,13,15)(H,16,17) |
| InChIKey | RIDUUPHFUJDWAL-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |