C9H9BrF2N2O4S — CID 114189095
N-(2-bromoethyl)-2,4-difluoro-N-methyl-5-nitrobenzenesulfonamide (PubChem CID 114189095) has the molecular formula C9H9BrF2N2O4S and a molecular weight of 359.15 g/mol. Its IUPAC name is N-(2-bromoethyl)-2,4-difluoro-N-methyl-5-nitrobenzenesulfonamide.
| Compound Name | N-(2-bromoethyl)-2,4-difluoro-N-methyl-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 114189095 |
| Molecular Formula | C9H9BrF2N2O4S |
| Molecular Weight | 359.15 g/mol |
| Exact Mass | 357.94 |
| IUPAC Name | N-(2-bromoethyl)-2,4-difluoro-N-methyl-5-nitrobenzenesulfonamide |
| SMILES | CN(CCBr)S(=O)(=O)c1cc([N+](=O)[O-])c(F)cc1F |
| InChI | InChI=1S/C9H9BrF2N2O4S/c1-13(3-2-10)19(17,18)9-5-8(14(15)16)6(11)4-7(9)12/h4-5H,2-3H2,1H3 |
| InChIKey | AANOFXQIRDVWSN-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.15 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|