C12H17FN2O4S2 — CID 115967662
4-fluoro-N,2-dimethyl-N-(1-methylsulfanylpropan-2-yl)-5-nitrobenzenesulfonamide (PubChem CID 115967662) has the molecular formula C12H17FN2O4S2 and a molecular weight of 336.41 g/mol. Its IUPAC name is 4-fluoro-N,2-dimethyl-N-(1-methylsulfanylpropan-2-yl)-5-nitrobenzenesulfonamide.
| Compound Name | 4-fluoro-N,2-dimethyl-N-(1-methylsulfanylpropan-2-yl)-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 115967662 |
| Molecular Formula | C12H17FN2O4S2 |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | 4-fluoro-N,2-dimethyl-N-(1-methylsulfanylpropan-2-yl)-5-nitrobenzenesulfonamide |
| SMILES | CSCC(C)N(C)S(=O)(=O)c1cc([N+](=O)[O-])c(F)cc1C |
| InChI | InChI=1S/C12H17FN2O4S2/c1-8-5-10(13)11(15(16)17)6-12(8)21(18,19)14(3)9(2)7-20-4/h5-6,9H,7H2,1-4H3 |
| InChIKey | IASCTMTTYAACEX-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|