C20H25FN6O2S — CID 11419069
[5-(tert-butylcarbamothioylamino)-2-pyridinyl] 4-(5-fluoro-2-pyridinyl)piperazine-1-carboxylate (PubChem CID 11419069) has the molecular formula C20H25FN6O2S and a molecular weight of 432.53 g/mol. Its IUPAC name is [5-(tert-butylcarbamothioylamino)-2-pyridinyl] 4-(5-fluoro-2-pyridinyl)piperazine-1-carboxylate.
| Compound Name | [5-(tert-butylcarbamothioylamino)-2-pyridinyl] 4-(5-fluoro-2-pyridinyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 11419069 |
| Molecular Formula | C20H25FN6O2S |
| Molecular Weight | 432.53 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | [5-(tert-butylcarbamothioylamino)-2-pyridinyl] 4-(5-fluoro-2-pyridinyl)piperazine-1-carboxylate |
| SMILES | CC(C)(C)NC(=S)Nc1ccc(OC(=O)N2CCN(c3ccc(F)cn3)CC2)nc1 |
| InChI | InChI=1S/C20H25FN6O2S/c1-20(2,3)25-18(30)24-15-5-7-17(23-13-15)29-19(28)27-10-8-26(9-11-27)16-6-4-14(21)12-22-16/h4-7,12-13H,8-11H2,1-3H3,(H2,24,25,30) |
| InChIKey | UROAJNLRQVFUGJ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.53 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|