C22H29F3N4O3Si — CID 150291106
[5-[tert-butyl(dimethyl)silyl]oxy-2-pyridinyl] 4-[5-(trifluoromethyl)-2-pyridinyl]piperazine-1-carboxylate (PubChem CID 150291106) has the molecular formula C22H29F3N4O3Si and a molecular weight of 482.58 g/mol. Its IUPAC name is [5-[tert-butyl(dimethyl)silyl]oxy-2-pyridinyl] 4-[5-(trifluoromethyl)-2-pyridinyl]piperazine-1-carboxylate.
| Compound Name | [5-[tert-butyl(dimethyl)silyl]oxy-2-pyridinyl] 4-[5-(trifluoromethyl)-2-pyridinyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 150291106 |
| Molecular Formula | C22H29F3N4O3Si |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.20 |
| IUPAC Name | [5-[tert-butyl(dimethyl)silyl]oxy-2-pyridinyl] 4-[5-(trifluoromethyl)-2-pyridinyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc(OC(=O)N2CCN(c3ccc(C(F)(F)F)cn3)CC2)nc1 |
| InChI | InChI=1S/C22H29F3N4O3Si/c1-21(2,3)33(4,5)32-17-7-9-19(27-15-17)31-20(30)29-12-10-28(11-13-29)18-8-6-16(14-26-18)22(23,24)25/h6-9,14-15H,10-13H2,1-5H3 |
| InChIKey | GHPLIFOMJYFDKQ-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 67.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|