C14H20N2O2 — CID 114198795
methyl 2-[[(1-ethylcyclobutyl)amino]methyl]pyridine-3-carboxylate (PubChem CID 114198795) has the molecular formula C14H20N2O2 and a molecular weight of 248.33 g/mol. Its IUPAC name is methyl 2-[[(1-ethylcyclobutyl)amino]methyl]pyridine-3-carboxylate.
| Compound Name | methyl 2-[[(1-ethylcyclobutyl)amino]methyl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 114198795 |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | methyl 2-[[(1-ethylcyclobutyl)amino]methyl]pyridine-3-carboxylate |
| SMILES | CCC1(NCc2ncccc2C(=O)OC)CCC1 |
| InChI | InChI=1S/C14H20N2O2/c1-3-14(7-5-8-14)16-10-12-11(13(17)18-2)6-4-9-15-12/h4,6,9,16H,3,5,7-8,10H2,1-2H3 |
| InChIKey | KNNCGIGEKIPXHN-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |