C14H30N2O4S2 — CID 11420031
N-[(1R,2R)-2-(butylsulfonylamino)cyclohexyl]butane-1-sulfonamide (PubChem CID 11420031) has the molecular formula C14H30N2O4S2 and a molecular weight of 354.54 g/mol. Its IUPAC name is N-[(1R,2R)-2-(butylsulfonylamino)cyclohexyl]butane-1-sulfonamide.
| Compound Name | N-[(1R,2R)-2-(butylsulfonylamino)cyclohexyl]butane-1-sulfonamide |
|---|---|
| PubChem CID | 11420031 |
| Molecular Formula | C14H30N2O4S2 |
| Molecular Weight | 354.54 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | N-[(1R,2R)-2-(butylsulfonylamino)cyclohexyl]butane-1-sulfonamide |
| SMILES | CCCCS(=O)(=O)N[C@@H]1CCCC[C@H]1NS(=O)(=O)CCCC |
| InChI | InChI=1S/C14H30N2O4S2/c1-3-5-11-21(17,18)15-13-9-7-8-10-14(13)16-22(19,20)12-6-4-2/h13-16H,3-12H2,1-2H3/t13-,14-/m1/s1 |
| InChIKey | JUGCCRUREILMAM-ZIAGYGMSSA-N |
| XLogP | 1.74 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.54 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |