C13H22N2O3 — CID 114202691
(2S)-3,3-dimethyl-2-(4-methylpent-1-yn-3-ylcarbamoylamino)butanoic acid (PubChem CID 114202691) has the molecular formula C13H22N2O3 and a molecular weight of 254.33 g/mol. Its IUPAC name is (2S)-3,3-dimethyl-2-(4-methylpent-1-yn-3-ylcarbamoylamino)butanoic acid.
| Compound Name | (2S)-3,3-dimethyl-2-(4-methylpent-1-yn-3-ylcarbamoylamino)butanoic acid |
|---|---|
| PubChem CID | 114202691 |
| Molecular Formula | C13H22N2O3 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | (2S)-3,3-dimethyl-2-(4-methylpent-1-yn-3-ylcarbamoylamino)butanoic acid |
| SMILES | C#CC(NC(=O)N[C@H](C(=O)O)C(C)(C)C)C(C)C |
| InChI | InChI=1S/C13H22N2O3/c1-7-9(8(2)3)14-12(18)15-10(11(16)17)13(4,5)6/h1,8-10H,2-6H3,(H,16,17)(H2,14,15,18)/t9?,10-/m1/s1 |
| InChIKey | RFFCMVBLDBONDH-QVDQXJPCSA-N |
| XLogP | 1.44 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|