C11H14N6OS — CID 114220560
2-hydrazinyl-6-methyl-N-[(2-methyl-1,3-thiazol-5-yl)methyl]pyrimidine-4-carboxamide (PubChem CID 114220560) has the molecular formula C11H14N6OS and a molecular weight of 278.34 g/mol. Its IUPAC name is 2-hydrazinyl-6-methyl-N-[(2-methyl-1,3-thiazol-5-yl)methyl]pyrimidine-4-carboxamide.
| Compound Name | 2-hydrazinyl-6-methyl-N-[(2-methyl-1,3-thiazol-5-yl)methyl]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 114220560 |
| Molecular Formula | C11H14N6OS |
| Molecular Weight | 278.34 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 2-hydrazinyl-6-methyl-N-[(2-methyl-1,3-thiazol-5-yl)methyl]pyrimidine-4-carboxamide |
| SMILES | Cc1cc(C(=O)NCc2cnc(C)s2)nc(NN)n1 |
| InChI | InChI=1S/C11H14N6OS/c1-6-3-9(16-11(15-6)17-12)10(18)14-5-8-4-13-7(2)19-8/h3-4H,5,12H2,1-2H3,(H,14,18)(H,15,16,17) |
| InChIKey | LSHRNLZKCHFTNY-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 105.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.34 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|