C13H24F2OS — CID 114224697
1-tert-butylsulfanyl-3-(3,3-difluorocyclohexyl)propan-2-ol (PubChem CID 114224697) has the molecular formula C13H24F2OS and a molecular weight of 266.40 g/mol. Its IUPAC name is 1-tert-butylsulfanyl-3-(3,3-difluorocyclohexyl)propan-2-ol.
| Compound Name | 1-tert-butylsulfanyl-3-(3,3-difluorocyclohexyl)propan-2-ol |
|---|---|
| PubChem CID | 114224697 |
| Molecular Formula | C13H24F2OS |
| Molecular Weight | 266.40 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 1-tert-butylsulfanyl-3-(3,3-difluorocyclohexyl)propan-2-ol |
| SMILES | CC(C)(C)SCC(O)CC1CCCC(F)(F)C1 |
| InChI | InChI=1S/C13H24F2OS/c1-12(2,3)17-9-11(16)7-10-5-4-6-13(14,15)8-10/h10-11,16H,4-9H2,1-3H3 |
| InChIKey | ZIAVZAUYLKGGSB-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.40 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |