C16H27ClF2 — CID 114225012
4-tert-butyl-1-chloro-2-[(3,3-difluorocyclopentyl)methyl]cyclohexane (PubChem CID 114225012) has the molecular formula C16H27ClF2 and a molecular weight of 292.84 g/mol. Its IUPAC name is 4-tert-butyl-1-chloro-2-[(3,3-difluorocyclopentyl)methyl]cyclohexane.
| Compound Name | 4-tert-butyl-1-chloro-2-[(3,3-difluorocyclopentyl)methyl]cyclohexane |
|---|---|
| PubChem CID | 114225012 |
| Molecular Formula | C16H27ClF2 |
| Molecular Weight | 292.84 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | 4-tert-butyl-1-chloro-2-[(3,3-difluorocyclopentyl)methyl]cyclohexane |
| SMILES | CC(C)(C)C1CCC(Cl)C(CC2CCC(F)(F)C2)C1 |
| InChI | InChI=1S/C16H27ClF2/c1-15(2,3)13-4-5-14(17)12(9-13)8-11-6-7-16(18,19)10-11/h11-14H,4-10H2,1-3H3 |
| InChIKey | FRGYIVZPOFFLOP-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.84 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|