C15H24Cl2F2 — CID 114225467
3-[3-chloro-2-(chloromethyl)-2-cyclopentylpropyl]-1,1-difluorocyclohexane (PubChem CID 114225467) has the molecular formula C15H24Cl2F2 and a molecular weight of 313.26 g/mol. Its IUPAC name is 3-[3-chloro-2-(chloromethyl)-2-cyclopentylpropyl]-1,1-difluorocyclohexane.
| Compound Name | 3-[3-chloro-2-(chloromethyl)-2-cyclopentylpropyl]-1,1-difluorocyclohexane |
|---|---|
| PubChem CID | 114225467 |
| Molecular Formula | C15H24Cl2F2 |
| Molecular Weight | 313.26 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | 3-[3-chloro-2-(chloromethyl)-2-cyclopentylpropyl]-1,1-difluorocyclohexane |
| SMILES | FC1(F)CCCC(CC(CCl)(CCl)C2CCCC2)C1 |
| InChI | InChI=1S/C15H24Cl2F2/c16-10-14(11-17,13-5-1-2-6-13)8-12-4-3-7-15(18,19)9-12/h12-13H,1-11H2 |
| InChIKey | BBMCLMBTTCWCFS-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.26 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|