C11H21F2NO2S — CID 114225517
4-[(3,3-difluorocyclohexyl)methylsulfonyl]butan-2-amine (PubChem CID 114225517) has the molecular formula C11H21F2NO2S and a molecular weight of 269.36 g/mol. Its IUPAC name is 4-[(3,3-difluorocyclohexyl)methylsulfonyl]butan-2-amine.
| Compound Name | 4-[(3,3-difluorocyclohexyl)methylsulfonyl]butan-2-amine |
|---|---|
| PubChem CID | 114225517 |
| Molecular Formula | C11H21F2NO2S |
| Molecular Weight | 269.36 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | 4-[(3,3-difluorocyclohexyl)methylsulfonyl]butan-2-amine |
| SMILES | CC(N)CCS(=O)(=O)CC1CCCC(F)(F)C1 |
| InChI | InChI=1S/C11H21F2NO2S/c1-9(14)4-6-17(15,16)8-10-3-2-5-11(12,13)7-10/h9-10H,2-8,14H2,1H3 |
| InChIKey | BZWNPIYCRNFAJO-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.36 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |