C12H17ClN2O4 — CID 114226939
4-[(4-chloro-1-methylpyrrole-2-carbonyl)amino]-3-ethoxybutanoic acid (PubChem CID 114226939) has the molecular formula C12H17ClN2O4 and a molecular weight of 288.73 g/mol. Its IUPAC name is 4-[(4-chloro-1-methylpyrrole-2-carbonyl)amino]-3-ethoxybutanoic acid.
| Compound Name | 4-[(4-chloro-1-methylpyrrole-2-carbonyl)amino]-3-ethoxybutanoic acid |
|---|---|
| PubChem CID | 114226939 |
| Molecular Formula | C12H17ClN2O4 |
| Molecular Weight | 288.73 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 4-[(4-chloro-1-methylpyrrole-2-carbonyl)amino]-3-ethoxybutanoic acid |
| SMILES | CCOC(CNC(=O)c1cc(Cl)cn1C)CC(=O)O |
| InChI | InChI=1S/C12H17ClN2O4/c1-3-19-9(5-11(16)17)6-14-12(18)10-4-8(13)7-15(10)2/h4,7,9H,3,5-6H2,1-2H3,(H,14,18)(H,16,17) |
| InChIKey | ZSCACAOAQRDNAA-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 80.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.73 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |