C16H27NO2 — CID 114228009
1-[(2E)-cyclooct-2-en-1-yl]-3-ethylpiperidine-3-carboxylic acid (PubChem CID 114228009) has the molecular formula C16H27NO2 and a molecular weight of 265.40 g/mol. Its IUPAC name is 1-[(2E)-cyclooct-2-en-1-yl]-3-ethylpiperidine-3-carboxylic acid.
| Compound Name | 1-[(2E)-cyclooct-2-en-1-yl]-3-ethylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 114228009 |
| Molecular Formula | C16H27NO2 |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.20 |
| IUPAC Name | 1-[(2E)-cyclooct-2-en-1-yl]-3-ethylpiperidine-3-carboxylic acid |
| SMILES | CCC1(C(=O)O)CCCN(C2/C=C\CCCCC2)C1 |
| InChI | InChI=1S/C16H27NO2/c1-2-16(15(18)19)11-8-12-17(13-16)14-9-6-4-3-5-7-10-14/h6,9,14H,2-5,7-8,10-13H2,1H3,(H,18,19)/b9-6- |
| InChIKey | BPWPBUIORBPJJV-TWGQIWQCSA-N |
| XLogP | 3.45 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|