C13H23N3OS — CID 114234320
2-[3-cyano-3-(ethylamino)cyclopentyl]sulfanyl-N-propylacetamide (PubChem CID 114234320) has the molecular formula C13H23N3OS and a molecular weight of 269.41 g/mol. Its IUPAC name is 2-[3-cyano-3-(ethylamino)cyclopentyl]sulfanyl-N-propylacetamide.
| Compound Name | 2-[3-cyano-3-(ethylamino)cyclopentyl]sulfanyl-N-propylacetamide |
|---|---|
| PubChem CID | 114234320 |
| Molecular Formula | C13H23N3OS |
| Molecular Weight | 269.41 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | 2-[3-cyano-3-(ethylamino)cyclopentyl]sulfanyl-N-propylacetamide |
| SMILES | CCCNC(=O)CSC1CCC(C#N)(NCC)C1 |
| InChI | InChI=1S/C13H23N3OS/c1-3-7-15-12(17)9-18-11-5-6-13(8-11,10-14)16-4-2/h11,16H,3-9H2,1-2H3,(H,15,17) |
| InChIKey | IUNLKJQLVRXFRJ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.41 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |