C12H15N5OS — CID 114235259
N-ethyl-2-(2-hydrazinylquinazolin-4-yl)sulfanylacetamide (PubChem CID 114235259) has the molecular formula C12H15N5OS and a molecular weight of 277.35 g/mol. Its IUPAC name is N-ethyl-2-(2-hydrazinylquinazolin-4-yl)sulfanylacetamide.
| Compound Name | N-ethyl-2-(2-hydrazinylquinazolin-4-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 114235259 |
| Molecular Formula | C12H15N5OS |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | N-ethyl-2-(2-hydrazinylquinazolin-4-yl)sulfanylacetamide |
| SMILES | CCNC(=O)CSc1nc(NN)nc2ccccc12 |
| InChI | InChI=1S/C12H15N5OS/c1-2-14-10(18)7-19-11-8-5-3-4-6-9(8)15-12(16-11)17-13/h3-6H,2,7,13H2,1H3,(H,14,18)(H,15,16,17) |
| InChIKey | JDRCHUMJFWGOPO-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|